Si 363 is a bifunctional organosilane chemical used in the reinforcement of rubber articles, especially tires. SI363 is the trade name of a silane bonding agent in the trialkoxymercaptoalkyl-silane class and of formula SH(CH2)H3Si(OCHH2CHH3)(O(CHH2CHH2O)H5(CHH2)H12CHH3)H2.
When applied to tires, Si 363 reduces rolling resistance, thus leading to increased fuel economy. Both alkoxsilicon and sulfur entities are present within its molecular structure.
References
Si 363 Wikipedia(Text) CC BY-SA